About 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide
3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide (PubChem CID 141425120) has the molecular formula C10H9BrN2O2S
and a molecular weight of 301.17 g/mol. Its IUPAC name is 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide.
Molecular Properties
| Compound Name | 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide |
| PubChem CID | 141425120 |
| Molecular Formula | C10H9BrN2O2S |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide |
| SMILES | O=C(CCBr)Nc1cccc2s[nH]c(=O)c12 |
| InChI | InChI=1S/C10H9BrN2O2S/c11-5-4-8(14)12-6-2-1-3-7-9(6)10(15)13-16-7/h1-3H,4-5H2,(H,12,14)(H,13,15) |
| InChIKey | DGQKJSYJKJYVCI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide?
The IUPAC name of 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide (CID 141425120) is 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide.
What is the SMILES notation for 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide?
The canonical SMILES for 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide is O=C(CCBr)Nc1cccc2s[nH]c(=O)c12.
What is the InChIKey of 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide?
The InChIKey is DGQKJSYJKJYVCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O2S/c11-5-4-8(14)12-6-2-1-3-7-9(6)10(15)13-16-7/h1-3H,4-5H2,(H,12,14)(H,13,15).
What are the key properties of 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide?
3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide has a molecular weight of 301.17 g/mol, XLogP of 2.31, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(3-oxo-1,2-benzothiazol-4-yl)propanamide is sourced from PubChem (CID 141425120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).