About 4-amino-1,2-benzothiazol-3-one
4-amino-1,2-benzothiazol-3-one (PubChem CID 67635988) has the molecular formula C7H6N2OS
and a molecular weight of 166.21 g/mol. Its IUPAC name is 4-amino-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 4-amino-1,2-benzothiazol-3-one |
| PubChem CID | 67635988 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 4-amino-1,2-benzothiazol-3-one |
| SMILES | Nc1cccc2s[nH]c(=O)c12 |
| InChI | InChI=1S/C7H6N2OS/c8-4-2-1-3-5-6(4)7(10)9-11-5/h1-3H,8H2,(H,9,10) |
| InChIKey | VTYLPJPNDHNHQN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,2-benzothiazol-3-one?
The IUPAC name of 4-amino-1,2-benzothiazol-3-one (CID 67635988) is 4-amino-1,2-benzothiazol-3-one.
What is the SMILES notation for 4-amino-1,2-benzothiazol-3-one?
The canonical SMILES for 4-amino-1,2-benzothiazol-3-one is Nc1cccc2s[nH]c(=O)c12.
What is the InChIKey of 4-amino-1,2-benzothiazol-3-one?
The InChIKey is VTYLPJPNDHNHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c8-4-2-1-3-5-6(4)7(10)9-11-5/h1-3H,8H2,(H,9,10).
What are the key properties of 4-amino-1,2-benzothiazol-3-one?
4-amino-1,2-benzothiazol-3-one has a molecular weight of 166.21 g/mol, XLogP of 1.17, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,2-benzothiazol-3-one is sourced from PubChem (CID 67635988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).