C14H12N4S — CID 141425890
N-benzyl-N-pyridin-2-yl-1,3,4-thiadiazol-2-amine (PubChem CID 141425890) has the molecular formula C14H12N4S and a molecular weight of 268.35 g/mol. Its IUPAC name is N-benzyl-N-pyridin-2-yl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-benzyl-N-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 141425890 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-benzyl-N-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc(CN(c2ccccn2)c2nncs2)cc1 |
| InChI | InChI=1S/C14H12N4S/c1-2-6-12(7-3-1)10-18(14-17-16-11-19-14)13-8-4-5-9-15-13/h1-9,11H,10H2 |
| InChIKey | OQPJHNSLJHHBIQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |