C11H13N5OS — CID 77021390
N'-hydroxy-3-[N-(1,3,4-thiadiazol-2-yl)anilino]propanimidamide (PubChem CID 77021390) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is N'-hydroxy-3-[N-(1,3,4-thiadiazol-2-yl)anilino]propanimidamide.
| Compound Name | N'-hydroxy-3-[N-(1,3,4-thiadiazol-2-yl)anilino]propanimidamide |
|---|---|
| PubChem CID | 77021390 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N'-hydroxy-3-[N-(1,3,4-thiadiazol-2-yl)anilino]propanimidamide |
| SMILES | NC(CCN(c1ccccc1)c1nncs1)=NO |
| InChI | InChI=1S/C11H13N5OS/c12-10(15-17)6-7-16(11-14-13-8-18-11)9-4-2-1-3-5-9/h1-5,8,17H,6-7H2,(H2,12,15) |
| InChIKey | CNYUBLNZDYCKFQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|