C14H19N5OS — CID 77064299
N'-hydroxy-3-(N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)anilino)propanimidamide (PubChem CID 77064299) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is N'-hydroxy-3-(N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)anilino)propanimidamide.
| Compound Name | N'-hydroxy-3-(N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)anilino)propanimidamide |
|---|---|
| PubChem CID | 77064299 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N'-hydroxy-3-(N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)anilino)propanimidamide |
| SMILES | CC(C)c1nsc(N(CCC(N)=NO)c2ccccc2)n1 |
| InChI | InChI=1S/C14H19N5OS/c1-10(2)13-16-14(21-18-13)19(9-8-12(15)17-20)11-6-4-3-5-7-11/h3-7,10,20H,8-9H2,1-2H3,(H2,15,17) |
| InChIKey | OQOOBKNMNBVQAW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|