C11H15N7O — CID 55166554
N'-hydroxy-3-(N-(1-methyltetrazol-5-yl)anilino)propanimidamide (PubChem CID 55166554) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is N'-hydroxy-3-(N-(1-methyltetrazol-5-yl)anilino)propanimidamide.
| Compound Name | N'-hydroxy-3-(N-(1-methyltetrazol-5-yl)anilino)propanimidamide |
|---|---|
| PubChem CID | 55166554 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N'-hydroxy-3-(N-(1-methyltetrazol-5-yl)anilino)propanimidamide |
| SMILES | Cn1nnnc1N(CC/C(N)=N/O)c1ccccc1 |
| InChI | InChI=1S/C11H15N7O/c1-17-11(13-15-16-17)18(8-7-10(12)14-19)9-5-3-2-4-6-9/h2-6,19H,7-8H2,1H3,(H2,12,14) |
| InChIKey | JWMMNYGSGJTCDD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|