C16H13F3N4 — CID 141428953
4-[5-[2-methyl-5-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl]pyrimidin-2-amine (PubChem CID 141428953) has the molecular formula C16H13F3N4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 4-[5-[2-methyl-5-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl]pyrimidin-2-amine.
| Compound Name | 4-[5-[2-methyl-5-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141428953 |
| Molecular Formula | C16H13F3N4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-[5-[2-methyl-5-(trifluoromethyl)phenyl]-1H-pyrrol-2-yl]pyrimidin-2-amine |
| SMILES | Cc1ccc(C(F)(F)F)cc1-c1ccc(-c2ccnc(N)n2)[nH]1 |
| InChI | InChI=1S/C16H13F3N4/c1-9-2-3-10(16(17,18)19)8-11(9)12-4-5-13(22-12)14-6-7-21-15(20)23-14/h2-8,22H,1H3,(H2,20,21,23) |
| InChIKey | KJFQBTJUYSMUBT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |