C14H14F3N3 — CID 157068956
4-ethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 157068956) has the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. Its IUPAC name is 4-ethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-ethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 157068956 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-ethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | CCc1cc(-c2cc(C(F)(F)F)ccc2C)nc(N)n1 |
| InChI | InChI=1S/C14H14F3N3/c1-3-10-7-12(20-13(18)19-10)11-6-9(14(15,16)17)5-4-8(11)2/h4-7H,3H2,1-2H3,(H2,18,19,20) |
| InChIKey | JLJRUKKFLURWFP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |