C18H15F3N2 — CID 137425290
2,5-dimethyl-4-[6-(trifluoromethyl)quinolin-2-yl]aniline (PubChem CID 137425290) has the molecular formula C18H15F3N2 and a molecular weight of 316.33 g/mol. Its IUPAC name is 2,5-dimethyl-4-[6-(trifluoromethyl)quinolin-2-yl]aniline.
| Compound Name | 2,5-dimethyl-4-[6-(trifluoromethyl)quinolin-2-yl]aniline |
|---|---|
| PubChem CID | 137425290 |
| Molecular Formula | C18H15F3N2 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2,5-dimethyl-4-[6-(trifluoromethyl)quinolin-2-yl]aniline |
| SMILES | Cc1cc(-c2ccc3cc(C(F)(F)F)ccc3n2)c(C)cc1N |
| InChI | InChI=1S/C18H15F3N2/c1-10-8-15(22)11(2)7-14(10)17-5-3-12-9-13(18(19,20)21)4-6-16(12)23-17/h3-9H,22H2,1-2H3 |
| InChIKey | WSTQSJWXDOEDIE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|