C15H17N5O — CID 141429270
1-[4-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)piperidin-1-yl]ethanone (PubChem CID 141429270) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[4-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 141429270 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-[4-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)piperidin-1-yl]ethanone |
| SMILES | C#Cc1cn(C2CCN(C(C)=O)CC2)c2ncnc(N)c12 |
| InChI | InChI=1S/C15H17N5O/c1-3-11-8-20(15-13(11)14(16)17-9-18-15)12-4-6-19(7-5-12)10(2)21/h1,8-9,12H,4-7H2,2H3,(H2,16,17,18) |
| InChIKey | OPLBIWXKPJVWFQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|