C25H27N5O3 — CID 138463691
1-[3-[4-amino-5-[(3E,5E)-5,7-dimethoxy-3-methylocta-3,5,7-trien-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 138463691) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[3-[4-amino-5-[(3E,5E)-5,7-dimethoxy-3-methylocta-3,5,7-trien-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[3-[4-amino-5-[(3E,5E)-5,7-dimethoxy-3-methylocta-3,5,7-trien-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 138463691 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[3-[4-amino-5-[(3E,5E)-5,7-dimethoxy-3-methylocta-3,5,7-trien-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | C=C(/C=C(\C=C(/C)C#Cc1cn(C2CCN(C(=O)C#CC)C2)c2ncnc(N)c12)OC)OC |
| InChI | InChI=1S/C25H27N5O3/c1-6-7-22(31)29-11-10-20(15-29)30-14-19(23-24(26)27-16-28-25(23)30)9-8-17(2)12-21(33-5)13-18(3)32-4/h12-14,16,20H,3,10-11,15H2,1-2,4-5H3,(H2,26,27,28)/b17-12+,21-13+ |
| InChIKey | RTCUWAMNMUNEGT-ZQWOEWKVSA-N |
| XLogP | 2.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|