C7H5BrO3 — CID 141434308
2-(5-bromofuran-2-yl)-1,3-dioxole (PubChem CID 141434308) has the molecular formula C7H5BrO3 and a molecular weight of 217.02 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-1,3-dioxole.
| Compound Name | 2-(5-bromofuran-2-yl)-1,3-dioxole |
|---|---|
| PubChem CID | 141434308 |
| Molecular Formula | C7H5BrO3 |
| Molecular Weight | 217.02 g/mol |
| Exact Mass | 215.94 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-1,3-dioxole |
| SMILES | Brc1ccc(C2OC=CO2)o1 |
| InChI | InChI=1S/C7H5BrO3/c8-6-2-1-5(11-6)7-9-3-4-10-7/h1-4,7H |
| InChIKey | NXBPRACRTANKAZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.02 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |