C14H11FO4 — CID 141171878
[5-(1,3-dioxol-2-yl)furan-2-yl]-(4-fluorophenyl)methanol (PubChem CID 141171878) has the molecular formula C14H11FO4 and a molecular weight of 262.24 g/mol. Its IUPAC name is [5-(1,3-dioxol-2-yl)furan-2-yl]-(4-fluorophenyl)methanol.
| Compound Name | [5-(1,3-dioxol-2-yl)furan-2-yl]-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 141171878 |
| Molecular Formula | C14H11FO4 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | [5-(1,3-dioxol-2-yl)furan-2-yl]-(4-fluorophenyl)methanol |
| SMILES | OC(c1ccc(F)cc1)c1ccc(C2OC=CO2)o1 |
| InChI | InChI=1S/C14H11FO4/c15-10-3-1-9(2-4-10)13(16)11-5-6-12(19-11)14-17-7-8-18-14/h1-8,13-14,16H |
| InChIKey | BKCRVVUXJUFQEY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |