C8H10BrNOS — CID 66218265
2-(5-bromofuran-2-yl)-1,3-thiazinane (PubChem CID 66218265) has the molecular formula C8H10BrNOS and a molecular weight of 248.14 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-1,3-thiazinane.
| Compound Name | 2-(5-bromofuran-2-yl)-1,3-thiazinane |
|---|---|
| PubChem CID | 66218265 |
| Molecular Formula | C8H10BrNOS |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-1,3-thiazinane |
| SMILES | Brc1ccc(C2NCCCS2)o1 |
| InChI | InChI=1S/C8H10BrNOS/c9-7-3-2-6(11-7)8-10-4-1-5-12-8/h2-3,8,10H,1,4-5H2 |
| InChIKey | DHXHZAKUHOZGFL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |