C15H12ClF3N2O3 — CID 141434921
3-[[5-(2-chlorophenyl)-2-(trifluoromethyl)-1H-pyrrole-3-carbonyl]amino]propanoic acid (PubChem CID 141434921) has the molecular formula C15H12ClF3N2O3 and a molecular weight of 360.72 g/mol. Its IUPAC name is 3-[[5-(2-chlorophenyl)-2-(trifluoromethyl)-1H-pyrrole-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-(2-chlorophenyl)-2-(trifluoromethyl)-1H-pyrrole-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 141434921 |
| Molecular Formula | C15H12ClF3N2O3 |
| Molecular Weight | 360.72 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 3-[[5-(2-chlorophenyl)-2-(trifluoromethyl)-1H-pyrrole-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1cc(-c2ccccc2Cl)[nH]c1C(F)(F)F |
| InChI | InChI=1S/C15H12ClF3N2O3/c16-10-4-2-1-3-8(10)11-7-9(13(21-11)15(17,18)19)14(24)20-6-5-12(22)23/h1-4,7,21H,5-6H2,(H,20,24)(H,22,23) |
| InChIKey | AHBHTLOIAZGHLJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |