C16H16F3N3O2 — CID 141434927
N-(3-anilino-3-oxopropyl)-5-methyl-2-(trifluoromethyl)-1H-pyrrole-3-carboxamide (PubChem CID 141434927) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is N-(3-anilino-3-oxopropyl)-5-methyl-2-(trifluoromethyl)-1H-pyrrole-3-carboxamide.
| Compound Name | N-(3-anilino-3-oxopropyl)-5-methyl-2-(trifluoromethyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 141434927 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-(3-anilino-3-oxopropyl)-5-methyl-2-(trifluoromethyl)-1H-pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCC(=O)Nc2ccccc2)c(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C16H16F3N3O2/c1-10-9-12(14(21-10)16(17,18)19)15(24)20-8-7-13(23)22-11-5-3-2-4-6-11/h2-6,9,21H,7-8H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | DJSBDCWOOPKHBM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |