C4H9NO4 — CID 141435473
(2S)-2-hydroxy-4-(hydroxyamino)butanoic acid (PubChem CID 141435473) has the molecular formula C4H9NO4 and a molecular weight of 135.12 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-(hydroxyamino)butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-(hydroxyamino)butanoic acid |
|---|---|
| PubChem CID | 141435473 |
| Molecular Formula | C4H9NO4 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | (2S)-2-hydroxy-4-(hydroxyamino)butanoic acid |
| SMILES | O=C(O)[C@@H](O)CCNO |
| InChI | InChI=1S/C4H9NO4/c6-3(4(7)8)1-2-5-9/h3,5-6,9H,1-2H2,(H,7,8)/t3-/m0/s1 |
| InChIKey | LQYGWXVWALPNIZ-VKHMYHEASA-N |
| XLogP | -1.20 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|