C12H14F8O — CID 141435544
1,1,5,5-tetrafluoro-6-(2,2,6,6-tetrafluorohex-3-enoxy)hex-3-ene (PubChem CID 141435544) has the molecular formula C12H14F8O and a molecular weight of 326.23 g/mol. Its IUPAC name is 1,1,5,5-tetrafluoro-6-(2,2,6,6-tetrafluorohex-3-enoxy)hex-3-ene.
| Compound Name | 1,1,5,5-tetrafluoro-6-(2,2,6,6-tetrafluorohex-3-enoxy)hex-3-ene |
|---|---|
| PubChem CID | 141435544 |
| Molecular Formula | C12H14F8O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1,1,5,5-tetrafluoro-6-(2,2,6,6-tetrafluorohex-3-enoxy)hex-3-ene |
| SMILES | FC(F)CC=CC(F)(F)COCC(F)(F)C=CCC(F)F |
| InChI | InChI=1S/C12H14F8O/c13-9(14)3-1-5-11(17,18)7-21-8-12(19,20)6-2-4-10(15)16/h1-2,5-6,9-10H,3-4,7-8H2 |
| InChIKey | WRUIDCMLFNRGTL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|