About 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one
1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one (PubChem CID 141437424) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one |
| PubChem CID | 141437424 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one |
| SMILES | CSn1cnc(=O)c2c1CCC2 |
| InChI | InChI=1S/C8H10N2OS/c1-12-10-5-9-8(11)6-3-2-4-7(6)10/h5H,2-4H2,1H3 |
| InChIKey | XZOYHKKUOADCRT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The IUPAC name of 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one (CID 141437424) is 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one.
What is the SMILES notation for 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The canonical SMILES for 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one is CSn1cnc(=O)c2c1CCC2.
What is the InChIKey of 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The InChIKey is XZOYHKKUOADCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-12-10-5-9-8(11)6-3-2-4-7(6)10/h5H,2-4H2,1H3.
What are the key properties of 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one has a molecular weight of 182.25 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one is sourced from PubChem (CID 141437424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).