C11H18N2OS — CID 121224352
5-butyl-3,6-dimethyl-2-methylsulfanylpyrimidin-4-one (PubChem CID 121224352) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 5-butyl-3,6-dimethyl-2-methylsulfanylpyrimidin-4-one.
| Compound Name | 5-butyl-3,6-dimethyl-2-methylsulfanylpyrimidin-4-one |
|---|---|
| PubChem CID | 121224352 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-butyl-3,6-dimethyl-2-methylsulfanylpyrimidin-4-one |
| SMILES | CCCCc1c(C)nc(SC)n(C)c1=O |
| InChI | InChI=1S/C11H18N2OS/c1-5-6-7-9-8(2)12-11(15-4)13(3)10(9)14/h5-7H2,1-4H3 |
| InChIKey | PMCRGAKGZHBXRK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |