C12H16N2OS — CID 67962773
7-methyl-6-pentyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 67962773) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 7-methyl-6-pentyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-methyl-6-pentyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 67962773 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 7-methyl-6-pentyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCCc1c(C)nc2sccn2c1=O |
| InChI | InChI=1S/C12H16N2OS/c1-3-4-5-6-10-9(2)13-12-14(11(10)15)7-8-16-12/h7-8H,3-6H2,1-2H3 |
| InChIKey | AKTHQDHSAXKNQO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|