C20H24ClFN2O — CID 141438002
2-(3-chloro-4-fluorophenyl)-4-methoxy-N-[2-(1-methylpyrrolidin-2-yl)ethyl]aniline (PubChem CID 141438002) has the molecular formula C20H24ClFN2O and a molecular weight of 362.88 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-4-methoxy-N-[2-(1-methylpyrrolidin-2-yl)ethyl]aniline.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-4-methoxy-N-[2-(1-methylpyrrolidin-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 141438002 |
| Molecular Formula | C20H24ClFN2O |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-4-methoxy-N-[2-(1-methylpyrrolidin-2-yl)ethyl]aniline |
| SMILES | COc1ccc(NCCC2CCCN2C)c(-c2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C20H24ClFN2O/c1-24-11-3-4-15(24)9-10-23-20-8-6-16(25-2)13-17(20)14-5-7-19(22)18(21)12-14/h5-8,12-13,15,23H,3-4,9-11H2,1-2H3 |
| InChIKey | KLZANJFZOLRCNO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|