C9H19F3O4SSi — CID 141440101
1-[tert-butyl-methyl-(trifluoromethoxy)silyl]propane-2-sulfonic acid (PubChem CID 141440101) has the molecular formula C9H19F3O4SSi and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-[tert-butyl-methyl-(trifluoromethoxy)silyl]propane-2-sulfonic acid.
| Compound Name | 1-[tert-butyl-methyl-(trifluoromethoxy)silyl]propane-2-sulfonic acid |
|---|---|
| PubChem CID | 141440101 |
| Molecular Formula | C9H19F3O4SSi |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-[tert-butyl-methyl-(trifluoromethoxy)silyl]propane-2-sulfonic acid |
| SMILES | CC(C[Si](C)(OC(F)(F)F)C(C)(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C9H19F3O4SSi/c1-7(17(13,14)15)6-18(5,8(2,3)4)16-9(10,11)12/h7H,6H2,1-5H3,(H,13,14,15) |
| InChIKey | XTBGTOPZHQSVDO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|