About 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene
3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene (PubChem CID 141441485) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene.
Analyze 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene?
The IUPAC name of 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene (CID 141441485) is 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene.
What is the SMILES notation for 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene?
The canonical SMILES for 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene is C1=CC2CCCc3ccccc3C2=N1.
What is the InChIKey of 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene?
The InChIKey is GLUYGQCDTSNWTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N/c1-2-7-12-10(4-1)5-3-6-11-8-9-14-13(11)12/h1-2,4,7-9,11H,3,5-6H2.
What are the key properties of 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene?
3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene has a molecular weight of 183.25 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene is sourced from PubChem (CID 141441485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).