C12H10N2 — CID 141441491
3H-imidazo[2,1-a][2]benzazepine (PubChem CID 141441491) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 3H-imidazo[2,1-a][2]benzazepine.
| Compound Name | 3H-imidazo[2,1-a][2]benzazepine |
|---|---|
| PubChem CID | 141441491 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 3H-imidazo[2,1-a][2]benzazepine |
| SMILES | C1=CN2CC=NC2=c2ccccc2=C1 |
| InChI | InChI=1S/C12H10N2/c1-2-6-11-10(4-1)5-3-8-14-9-7-13-12(11)14/h1-8H,9H2 |
| InChIKey | RMWFLKGXFGQBDK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |