C11H13NO3S — CID 141441544
2-[(1,1-dioxothietan-3-yl)methyl]benzamide (PubChem CID 141441544) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[(1,1-dioxothietan-3-yl)methyl]benzamide.
| Compound Name | 2-[(1,1-dioxothietan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 141441544 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-[(1,1-dioxothietan-3-yl)methyl]benzamide |
| SMILES | NC(=O)c1ccccc1CC1CS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13NO3S/c12-11(13)10-4-2-1-3-9(10)5-8-6-16(14,15)7-8/h1-4,8H,5-7H2,(H2,12,13) |
| InChIKey | FHWYZZRFJOTCSF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |