C8H8Br2N2O — CID 14144188
N-(5-amino-2,4-dibromophenyl)acetamide (PubChem CID 14144188) has the molecular formula C8H8Br2N2O and a molecular weight of 307.97 g/mol. Its IUPAC name is N-(5-amino-2,4-dibromophenyl)acetamide.
| Compound Name | N-(5-amino-2,4-dibromophenyl)acetamide |
|---|---|
| PubChem CID | 14144188 |
| Molecular Formula | C8H8Br2N2O |
| Molecular Weight | 307.97 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | N-(5-amino-2,4-dibromophenyl)acetamide |
| SMILES | CC(=O)Nc1cc(N)c(Br)cc1Br |
| InChI | InChI=1S/C8H8Br2N2O/c1-4(13)12-8-3-7(11)5(9)2-6(8)10/h2-3H,11H2,1H3,(H,12,13) |
| InChIKey | OGRXJXQGLODGTI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.97 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|