C20H30O2 — CID 141443642
(5S,8R,9S,10S,13R,14S)-13-(hydroxymethyl)-1,10-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 141443642) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (5S,8R,9S,10S,13R,14S)-13-(hydroxymethyl)-1,10-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,8R,9S,10S,13R,14S)-13-(hydroxymethyl)-1,10-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 141443642 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (5S,8R,9S,10S,13R,14S)-13-(hydroxymethyl)-1,10-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1=CC(=O)C[C@@H]2CC[C@H]3[C@@H]4CCC[C@@]4(CO)CC[C@@H]3[C@@]12C |
| InChI | InChI=1S/C20H30O2/c1-13-10-15(22)11-14-5-6-16-17(19(13,14)2)7-9-20(12-21)8-3-4-18(16)20/h10,14,16-18,21H,3-9,11-12H2,1-2H3/t14-,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey | XIFOUROGMPXPLQ-PYNNRZRQSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |