C10H14F3N3O — CID 141444547
1-butyl-N-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide (PubChem CID 141444547) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is 1-butyl-N-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide.
| Compound Name | 1-butyl-N-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 141444547 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-butyl-N-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide |
| SMILES | CCCCn1ccc(C(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H14F3N3O/c1-2-3-5-16-6-4-8(15-16)9(17)14-7-10(11,12)13/h4,6H,2-3,5,7H2,1H3,(H,14,17) |
| InChIKey | KWTZMNQJJDJGPX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |