C9H12N4O2 — CID 141444837
2-(oxetan-3-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 141444837) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-(oxetan-3-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | 2-(oxetan-3-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 141444837 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(oxetan-3-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(NCC2COC2)n1 |
| InChI | InChI=1S/C9H12N4O2/c10-8(14)7-1-2-11-9(13-7)12-3-6-4-15-5-6/h1-2,6H,3-5H2,(H2,10,14)(H,11,12,13) |
| InChIKey | RLNRKVFCMFDNIK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |