About 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid
2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid (PubChem CID 166331126) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid |
| PubChem CID | 166331126 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NC[C@@H]2C[C@H](c3ccccc3)CO2)n1 |
| InChI | InChI=1S/C16H17N3O3/c20-15(21)14-6-7-17-16(19-14)18-9-13-8-12(10-22-13)11-4-2-1-3-5-11/h1-7,12-13H,8-10H2,(H,20,21)(H,17,18,19)/t12-,13-/m0/s1 |
| InChIKey | JCWNBMKYQHEFHM-STQMWFEESA-N |
| XLogP | 2.16 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid?
The IUPAC name of 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid (CID 166331126) is 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid.
What is the SMILES notation for 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid?
The canonical SMILES for 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid is O=C(O)c1ccnc(NC[C@@H]2C[C@H](c3ccccc3)CO2)n1.
What is the InChIKey of 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid?
The InChIKey is JCWNBMKYQHEFHM-STQMWFEESA-N. The full InChI is InChI=1S/C16H17N3O3/c20-15(21)14-6-7-17-16(19-14)18-9-13-8-12(10-22-13)11-4-2-1-3-5-11/h1-7,12-13H,8-10H2,(H,20,21)(H,17,18,19)/t12-,13-/m0/s1.
What are the key properties of 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid?
2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid has a molecular weight of 299.33 g/mol, XLogP of 2.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid is sourced from PubChem (CID 166331126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).