C16H17N3O3 — CID 166331126
2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid (PubChem CID 166331126) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid.
| Compound Name | 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 166331126 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[[(2S,4R)-4-phenyloxolan-2-yl]methylamino]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NC[C@@H]2C[C@H](c3ccccc3)CO2)n1 |
| InChI | InChI=1S/C16H17N3O3/c20-15(21)14-6-7-17-16(19-14)18-9-13-8-12(10-22-13)11-4-2-1-3-5-11/h1-7,12-13H,8-10H2,(H,20,21)(H,17,18,19)/t12-,13-/m0/s1 |
| InChIKey | JCWNBMKYQHEFHM-STQMWFEESA-N |
| XLogP | 2.16 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |