C22H24FN3O3 — CID 141446527
(2S)-4-[2-[2-(3-fluorophenyl)-7-methoxyquinoxalin-6-yl]oxyethyl]-2-methylmorpholine (PubChem CID 141446527) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is (2S)-4-[2-[2-(3-fluorophenyl)-7-methoxyquinoxalin-6-yl]oxyethyl]-2-methylmorpholine.
| Compound Name | (2S)-4-[2-[2-(3-fluorophenyl)-7-methoxyquinoxalin-6-yl]oxyethyl]-2-methylmorpholine |
|---|---|
| PubChem CID | 141446527 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (2S)-4-[2-[2-(3-fluorophenyl)-7-methoxyquinoxalin-6-yl]oxyethyl]-2-methylmorpholine |
| SMILES | COc1cc2nc(-c3cccc(F)c3)cnc2cc1OCCN1CCO[C@@H](C)C1 |
| InChI | InChI=1S/C22H24FN3O3/c1-15-14-26(6-8-28-15)7-9-29-22-11-18-19(12-21(22)27-2)25-20(13-24-18)16-4-3-5-17(23)10-16/h3-5,10-13,15H,6-9,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | DXLBNABHIDCBCF-HNNXBMFYSA-N |
| XLogP | 3.54 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |