C9H15NO5 — CID 141447931
(3R,3aR,6S,6aS)-6-ethoxy-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid (PubChem CID 141447931) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is (3R,3aR,6S,6aS)-6-ethoxy-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid.
| Compound Name | (3R,3aR,6S,6aS)-6-ethoxy-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 141447931 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (3R,3aR,6S,6aS)-6-ethoxy-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid |
| SMILES | CCO[C@H]1CN(C(=O)O)[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C9H15NO5/c1-2-14-6-3-10(9(12)13)7-5(11)4-15-8(6)7/h5-8,11H,2-4H2,1H3,(H,12,13)/t5-,6-,7+,8+/m0/s1 |
| InChIKey | DXFBYNJLLMKDKB-RULNZFCNSA-N |
| XLogP | -0.49 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |