C7H10FNO4 — CID 141120691
(3R,3aR,6S,6aS)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid (PubChem CID 141120691) has the molecular formula C7H10FNO4 and a molecular weight of 191.16 g/mol. Its IUPAC name is (3R,3aR,6S,6aS)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid.
| Compound Name | (3R,3aR,6S,6aS)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 141120691 |
| Molecular Formula | C7H10FNO4 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (3R,3aR,6S,6aS)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid |
| SMILES | O=C(O)N1C[C@H](F)[C@H]2OC[C@H](O)[C@H]21 |
| InChI | InChI=1S/C7H10FNO4/c8-3-1-9(7(11)12)5-4(10)2-13-6(3)5/h3-6,10H,1-2H2,(H,11,12)/t3-,4-,5+,6+/m0/s1 |
| InChIKey | PGKAZAFEVMKETP-UNTFVMJOSA-N |
| XLogP | -0.55 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |