C14H13ClN4O — CID 141451700
2-chloro-N-[3-cyano-1-(2,6-dimethylphenyl)pyrazol-5-yl]acetamide (PubChem CID 141451700) has the molecular formula C14H13ClN4O and a molecular weight of 288.74 g/mol. Its IUPAC name is 2-chloro-N-[3-cyano-1-(2,6-dimethylphenyl)pyrazol-5-yl]acetamide.
| Compound Name | 2-chloro-N-[3-cyano-1-(2,6-dimethylphenyl)pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 141451700 |
| Molecular Formula | C14H13ClN4O |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-chloro-N-[3-cyano-1-(2,6-dimethylphenyl)pyrazol-5-yl]acetamide |
| SMILES | Cc1cccc(C)c1-n1nc(C#N)cc1NC(=O)CCl |
| InChI | InChI=1S/C14H13ClN4O/c1-9-4-3-5-10(2)14(9)19-12(17-13(20)7-15)6-11(8-16)18-19/h3-6H,7H2,1-2H3,(H,17,20) |
| InChIKey | WDRSMXVSECGCHU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|