C12H23N3OS3 — CID 141452490
N-[1-[(1-sulfanyl-1,3,4-thiadiazol-1-yl)sulfanyl]octan-3-yl]acetamide (PubChem CID 141452490) has the molecular formula C12H23N3OS3 and a molecular weight of 321.54 g/mol. Its IUPAC name is N-[1-[(1-sulfanyl-1,3,4-thiadiazol-1-yl)sulfanyl]octan-3-yl]acetamide.
| Compound Name | N-[1-[(1-sulfanyl-1,3,4-thiadiazol-1-yl)sulfanyl]octan-3-yl]acetamide |
|---|---|
| PubChem CID | 141452490 |
| Molecular Formula | C12H23N3OS3 |
| Molecular Weight | 321.54 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-[1-[(1-sulfanyl-1,3,4-thiadiazol-1-yl)sulfanyl]octan-3-yl]acetamide |
| SMILES | CCCCCC(CCSS1(S)C=NN=C1)NC(C)=O |
| InChI | InChI=1S/C12H23N3OS3/c1-3-4-5-6-12(15-11(2)16)7-8-18-19(17)9-13-14-10-19/h9-10,12,17H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | IRABSCAVJSTTPS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|