C17H27Cl4NO — CID 20847803
N-(1,3,3,4-tetrachloropentadec-1-yn-8-yl)acetamide (PubChem CID 20847803) has the molecular formula C17H27Cl4NO and a molecular weight of 403.22 g/mol. Its IUPAC name is N-(1,3,3,4-tetrachloropentadec-1-yn-8-yl)acetamide.
| Compound Name | N-(1,3,3,4-tetrachloropentadec-1-yn-8-yl)acetamide |
|---|---|
| PubChem CID | 20847803 |
| Molecular Formula | C17H27Cl4NO |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-(1,3,3,4-tetrachloropentadec-1-yn-8-yl)acetamide |
| SMILES | CCCCCCCC(CCCC(Cl)C(Cl)(Cl)C#CCl)NC(C)=O |
| InChI | InChI=1S/C17H27Cl4NO/c1-3-4-5-6-7-9-15(22-14(2)23)10-8-11-16(19)17(20,21)12-13-18/h15-16H,3-11H2,1-2H3,(H,22,23) |
| InChIKey | WHPYMJPBAZAUSD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|