C13H7NO8 — CID 141453329
5-(2,5-dioxopyrrol-1-yl)benzene-1,2,3-tricarboxylic acid (PubChem CID 141453329) has the molecular formula C13H7NO8 and a molecular weight of 305.20 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)benzene-1,2,3-tricarboxylic acid.
| Compound Name | 5-(2,5-dioxopyrrol-1-yl)benzene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 141453329 |
| Molecular Formula | C13H7NO8 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)benzene-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)c1cc(N2C(=O)C=CC2=O)cc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C13H7NO8/c15-8-1-2-9(16)14(8)5-3-6(11(17)18)10(13(21)22)7(4-5)12(19)20/h1-4H,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | ZHIZGIKGTSHANA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|