C26H34N4O7 — CID 141453537
4-O-[[4-hydroxy-1-(oxan-4-yl)piperidin-4-yl]methylcarbamoyl] 1-O-(2-propan-2-ylindazol-3-yl) (E)-but-2-enedioate (PubChem CID 141453537) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is 4-O-[[4-hydroxy-1-(oxan-4-yl)piperidin-4-yl]methylcarbamoyl] 1-O-(2-propan-2-ylindazol-3-yl) (E)-but-2-enedioate.
| Compound Name | 4-O-[[4-hydroxy-1-(oxan-4-yl)piperidin-4-yl]methylcarbamoyl] 1-O-(2-propan-2-ylindazol-3-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 141453537 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 4-O-[[4-hydroxy-1-(oxan-4-yl)piperidin-4-yl]methylcarbamoyl] 1-O-(2-propan-2-ylindazol-3-yl) (E)-but-2-enedioate |
| SMILES | CC(C)n1nc2ccccc2c1OC(=O)/C=C/C(=O)OC(=O)NCC1(O)CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C26H34N4O7/c1-18(2)30-24(20-5-3-4-6-21(20)28-30)36-22(31)7-8-23(32)37-25(33)27-17-26(34)11-13-29(14-12-26)19-9-15-35-16-10-19/h3-8,18-19,34H,9-17H2,1-2H3,(H,27,33)/b8-7+ |
| InChIKey | JKOOVGKDIOMWDU-BQYQJAHWSA-N |
| XLogP | 2.34 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|