C27H36N4O6 — CID 141453534
4-O-[[1-(oxan-4-ylmethyl)piperidin-4-yl]methylcarbamoyl] 1-O-(2-propan-2-ylindazol-3-yl) (E)-but-2-enedioate (PubChem CID 141453534) has the molecular formula C27H36N4O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is 4-O-[[1-(oxan-4-ylmethyl)piperidin-4-yl]methylcarbamoyl] 1-O-(2-propan-2-ylindazol-3-yl) (E)-but-2-enedioate.
| Compound Name | 4-O-[[1-(oxan-4-ylmethyl)piperidin-4-yl]methylcarbamoyl] 1-O-(2-propan-2-ylindazol-3-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 141453534 |
| Molecular Formula | C27H36N4O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 4-O-[[1-(oxan-4-ylmethyl)piperidin-4-yl]methylcarbamoyl] 1-O-(2-propan-2-ylindazol-3-yl) (E)-but-2-enedioate |
| SMILES | CC(C)n1nc2ccccc2c1OC(=O)/C=C/C(=O)OC(=O)NCC1CCN(CC2CCOCC2)CC1 |
| InChI | InChI=1S/C27H36N4O6/c1-19(2)31-26(22-5-3-4-6-23(22)29-31)36-24(32)7-8-25(33)37-27(34)28-17-20-9-13-30(14-10-20)18-21-11-15-35-16-12-21/h3-8,19-21H,9-18H2,1-2H3,(H,28,34)/b8-7+ |
| InChIKey | HVPAMGORVWQGCB-BQYQJAHWSA-N |
| XLogP | 3.47 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|