C24H32N4O5 — CID 141453527
1-O-(2-propan-2-ylindazol-3-yl) 4-O-[(1-propan-2-ylpiperidin-4-yl)methylcarbamoyl] (E)-but-2-enedioate (PubChem CID 141453527) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is 1-O-(2-propan-2-ylindazol-3-yl) 4-O-[(1-propan-2-ylpiperidin-4-yl)methylcarbamoyl] (E)-but-2-enedioate.
| Compound Name | 1-O-(2-propan-2-ylindazol-3-yl) 4-O-[(1-propan-2-ylpiperidin-4-yl)methylcarbamoyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 141453527 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-O-(2-propan-2-ylindazol-3-yl) 4-O-[(1-propan-2-ylpiperidin-4-yl)methylcarbamoyl] (E)-but-2-enedioate |
| SMILES | CC(C)N1CCC(CNC(=O)OC(=O)/C=C/C(=O)Oc2c3ccccc3nn2C(C)C)CC1 |
| InChI | InChI=1S/C24H32N4O5/c1-16(2)27-13-11-18(12-14-27)15-25-24(31)33-22(30)10-9-21(29)32-23-19-7-5-6-8-20(19)26-28(23)17(3)4/h5-10,16-18H,11-15H2,1-4H3,(H,25,31)/b10-9+ |
| InChIKey | XHKBRFLOGGQSFQ-MDZDMXLPSA-N |
| XLogP | 3.45 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|