About N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium
N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium (PubChem CID 159657353) has the molecular formula C17H24N4OV
and a molecular weight of 351.35 g/mol. Its IUPAC name is N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium.
Molecular Properties
| Compound Name | N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium |
| PubChem CID | 159657353 |
| Molecular Formula | C17H24N4OV |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium |
| SMILES | CC(C)n1nc(C(=O)NCC2CCNCC2)c2ccccc21.[V] |
| InChI | InChI=1S/C17H24N4O.V/c1-12(2)21-15-6-4-3-5-14(15)16(20-21)17(22)19-11-13-7-9-18-10-8-13;/h3-6,12-13,18H,7-11H2,1-2H3,(H,19,22); |
| InChIKey | MSIOOMCRVFVKOS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium?
The IUPAC name of N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium (CID 159657353) is N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium.
What is the SMILES notation for N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium?
The canonical SMILES for N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium is CC(C)n1nc(C(=O)NCC2CCNCC2)c2ccccc21.[V].
What is the InChIKey of N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium?
The InChIKey is MSIOOMCRVFVKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O.V/c1-12(2)21-15-6-4-3-5-14(15)16(20-21)17(22)19-11-13-7-9-18-10-8-13;/h3-6,12-13,18H,7-11H2,1-2H3,(H,19,22);.
What are the key properties of N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium?
N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium has a molecular weight of 351.35 g/mol, XLogP of 2.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(piperidin-4-ylmethyl)-1-propan-2-ylindazole-3-carboxamide;vanadium is sourced from PubChem (CID 159657353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).