C26H34N4O — CID 11796305
N-[1-(4-phenylbutyl)piperidin-4-yl]-1-propan-2-ylindazole-3-carboxamide (PubChem CID 11796305) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is N-[1-(4-phenylbutyl)piperidin-4-yl]-1-propan-2-ylindazole-3-carboxamide.
| Compound Name | N-[1-(4-phenylbutyl)piperidin-4-yl]-1-propan-2-ylindazole-3-carboxamide |
|---|---|
| PubChem CID | 11796305 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | N-[1-(4-phenylbutyl)piperidin-4-yl]-1-propan-2-ylindazole-3-carboxamide |
| SMILES | CC(C)n1nc(C(=O)NC2CCN(CCCCc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H34N4O/c1-20(2)30-24-14-7-6-13-23(24)25(28-30)26(31)27-22-15-18-29(19-16-22)17-9-8-12-21-10-4-3-5-11-21/h3-7,10-11,13-14,20,22H,8-9,12,15-19H2,1-2H3,(H,27,31) |
| InChIKey | AHRROTRASDKRNS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|