C22H31N5O9 — CID 86751129
N-[2-(4-aminopiperidin-1-yl)ethyl]-1-propan-2-ylindazole-3-carboxamide;oxalic acid (PubChem CID 86751129) has the molecular formula C22H31N5O9 and a molecular weight of 509.52 g/mol. Its IUPAC name is N-[2-(4-aminopiperidin-1-yl)ethyl]-1-propan-2-ylindazole-3-carboxamide;oxalic acid.
| Compound Name | N-[2-(4-aminopiperidin-1-yl)ethyl]-1-propan-2-ylindazole-3-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 86751129 |
| Molecular Formula | C22H31N5O9 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[2-(4-aminopiperidin-1-yl)ethyl]-1-propan-2-ylindazole-3-carboxamide;oxalic acid |
| SMILES | CC(C)n1nc(C(=O)NCCN2CCC(N)CC2)c2ccccc21.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H27N5O.2C2H2O4/c1-13(2)23-16-6-4-3-5-15(16)17(21-23)18(24)20-9-12-22-10-7-14(19)8-11-22;2*3-1(4)2(5)6/h3-6,13-14H,7-12,19H2,1-2H3,(H,20,24);2*(H,3,4)(H,5,6) |
| InChIKey | PAXJLMJWQDMNLX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 225.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|