C23H37N5O — CID 15435295
N-[2-(4-butylpiperazin-1-yl)ethyl]-1-pentan-3-ylindazole-3-carboxamide (PubChem CID 15435295) has the molecular formula C23H37N5O and a molecular weight of 399.58 g/mol. Its IUPAC name is N-[2-(4-butylpiperazin-1-yl)ethyl]-1-pentan-3-ylindazole-3-carboxamide.
| Compound Name | N-[2-(4-butylpiperazin-1-yl)ethyl]-1-pentan-3-ylindazole-3-carboxamide |
|---|---|
| PubChem CID | 15435295 |
| Molecular Formula | C23H37N5O |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | N-[2-(4-butylpiperazin-1-yl)ethyl]-1-pentan-3-ylindazole-3-carboxamide |
| SMILES | CCCCN1CCN(CCNC(=O)c2nn(C(CC)CC)c3ccccc23)CC1 |
| InChI | InChI=1S/C23H37N5O/c1-4-7-13-26-15-17-27(18-16-26)14-12-24-23(29)22-20-10-8-9-11-21(20)28(25-22)19(5-2)6-3/h8-11,19H,4-7,12-18H2,1-3H3,(H,24,29) |
| InChIKey | MKWZQYWICZRXTB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |