C23H32N4O6 — CID 171354359
oxalic acid;N-[1-(oxan-4-yl)piperidin-4-yl]-1-propan-2-ylindazole-3-carboxamide (PubChem CID 171354359) has the molecular formula C23H32N4O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is oxalic acid;N-[1-(oxan-4-yl)piperidin-4-yl]-1-propan-2-ylindazole-3-carboxamide.
| Compound Name | oxalic acid;N-[1-(oxan-4-yl)piperidin-4-yl]-1-propan-2-ylindazole-3-carboxamide |
|---|---|
| PubChem CID | 171354359 |
| Molecular Formula | C23H32N4O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | oxalic acid;N-[1-(oxan-4-yl)piperidin-4-yl]-1-propan-2-ylindazole-3-carboxamide |
| SMILES | CC(C)n1nc(C(=O)NC2CCN(C3CCOCC3)CC2)c2ccccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H30N4O2.C2H2O4/c1-15(2)25-19-6-4-3-5-18(19)20(23-25)21(26)22-16-7-11-24(12-8-16)17-9-13-27-14-10-17;3-1(4)2(5)6/h3-6,15-17H,7-14H2,1-2H3,(H,22,26);(H,3,4)(H,5,6) |
| InChIKey | MYZMULWSDUCKMK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|