C19H27N5O7S — CID 159837138
N-[(3S,5S)-5-(methanesulfonamidomethyl)pyrrolidin-3-yl]-1-propan-2-ylindazole-3-carboxamide;oxalic acid (PubChem CID 159837138) has the molecular formula C19H27N5O7S and a molecular weight of 469.52 g/mol. Its IUPAC name is N-[(3S,5S)-5-(methanesulfonamidomethyl)pyrrolidin-3-yl]-1-propan-2-ylindazole-3-carboxamide;oxalic acid.
| Compound Name | N-[(3S,5S)-5-(methanesulfonamidomethyl)pyrrolidin-3-yl]-1-propan-2-ylindazole-3-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 159837138 |
| Molecular Formula | C19H27N5O7S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-[(3S,5S)-5-(methanesulfonamidomethyl)pyrrolidin-3-yl]-1-propan-2-ylindazole-3-carboxamide;oxalic acid |
| SMILES | CC(C)n1nc(C(=O)N[C@@H]2CN[C@H](CNS(C)(=O)=O)C2)c2ccccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H25N5O3S.C2H2O4/c1-11(2)22-15-7-5-4-6-14(15)16(21-22)17(23)20-13-8-12(18-9-13)10-19-26(3,24)25;3-1(4)2(5)6/h4-7,11-13,18-19H,8-10H2,1-3H3,(H,20,23);(H,3,4)(H,5,6)/t12-,13-;/m0./s1 |
| InChIKey | NOFMTRDAIHGLPC-QNTKWALQSA-N |
| XLogP | -0.22 |
| TPSA | 179.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|