C25H29N5O3 — CID 55517726
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide (PubChem CID 55517726) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55517726 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
| SMILES | CC(C)n1nc(C(=O)NC2CCN(CC(=O)Nc3ccccc3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H29N5O3/c1-17(2)30-25(33)21-11-7-6-10-20(21)23(28-30)24(32)27-19-12-14-29(15-13-19)16-22(31)26-18-8-4-3-5-9-18/h3-11,17,19H,12-16H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | JVBKWXHHNKFPNU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |