C25H29N5O3 — CID 55501814
3-(2-methylpropyl)-4-oxo-N-[1-(phenylcarbamoyl)piperidin-4-yl]phthalazine-1-carboxamide (PubChem CID 55501814) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-(2-methylpropyl)-4-oxo-N-[1-(phenylcarbamoyl)piperidin-4-yl]phthalazine-1-carboxamide.
| Compound Name | 3-(2-methylpropyl)-4-oxo-N-[1-(phenylcarbamoyl)piperidin-4-yl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55501814 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 3-(2-methylpropyl)-4-oxo-N-[1-(phenylcarbamoyl)piperidin-4-yl]phthalazine-1-carboxamide |
| SMILES | CC(C)Cn1nc(C(=O)NC2CCN(C(=O)Nc3ccccc3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H29N5O3/c1-17(2)16-30-24(32)21-11-7-6-10-20(21)22(28-30)23(31)26-19-12-14-29(15-13-19)25(33)27-18-8-4-3-5-9-18/h3-11,17,19H,12-16H2,1-2H3,(H,26,31)(H,27,33) |
| InChIKey | QITCPQPJSUVZMK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |