C12H10F12O — CID 141454662
1,1,1,6,6,6-hexafluoro-4-(1,1,1,6,6,6-hexafluorohex-4-en-3-yloxy)hex-2-ene (PubChem CID 141454662) has the molecular formula C12H10F12O and a molecular weight of 398.19 g/mol. Its IUPAC name is 1,1,1,6,6,6-hexafluoro-4-(1,1,1,6,6,6-hexafluorohex-4-en-3-yloxy)hex-2-ene.
| Compound Name | 1,1,1,6,6,6-hexafluoro-4-(1,1,1,6,6,6-hexafluorohex-4-en-3-yloxy)hex-2-ene |
|---|---|
| PubChem CID | 141454662 |
| Molecular Formula | C12H10F12O |
| Molecular Weight | 398.19 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1,1,1,6,6,6-hexafluoro-4-(1,1,1,6,6,6-hexafluorohex-4-en-3-yloxy)hex-2-ene |
| SMILES | FC(F)(F)C=CC(CC(F)(F)F)OC(C=CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C12H10F12O/c13-9(14,15)3-1-7(5-11(19,20)21)25-8(6-12(22,23)24)2-4-10(16,17)18/h1-4,7-8H,5-6H2 |
| InChIKey | KEQFFRDCEAWBCC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.19 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|